Bài 3. Đồ thị của hàm số y = ax + b (a ≠ 0)

Đây là phần 10 of 130 trong Series Toán lớp 9

Bài 3. Đồ thị của hàm số y = ax + b (a ≠ 0)

Lý thuyết đồ thị của hàm số y = ax + b (a ≠ 0).

A. Tóm tắt kiến thức:

1. Đồ thị hàm số y = ax + b (a ≠ 0).

Đồ thị của hàm số y = ax + b (a ≠ 0) là một đường thẳng:

- Cắt trục tung tại điểm có tung độ bằng b;

- Song song với đường thẳng y = ax nếu b ≠ 0 và trùng với đường thẳng y = ax nếu b = 0.

Đồ thị này cũng được gọi là đường thẳng y = ax + b và b được gọi là tung độ gốc của đường thẳng.

Lưu ý: Đồ thị y = ax + b cắt trục hoành tại điểm Q(-; 0).

2. Cách vẽ đồ thị của hàm số y = ax + b (a ≠ 0).

- Chọn điểm P(0; b) (trên 0y)

- Chọn điểm Q (-; 0) (trên Ox).

- Kẻ đường thẳng PQ.

Lưu ý: Vì đồ thị y = ax + b (a ≠ 0) là một đường thẳng nên muốn vẽ nó chỉ cần xác định hai điểm phân biệt thuộc đồ thị.

Do đó trong trường hợp giá trị - khó xác định trên trục Ox thì ta có thể thay điểm Q bằng cách chọn một giá trị x1  của x sao cho điểm Q'(x1, y1 ) (trong đó y1 = ax1 + b) dễ xác định hơn trong mặt phẳng tọa độ.

B.Bài tập và lời giải

Bài 15.

a) Vẽ đồ thị của các hàm số y=2x;y=2x+5;y=23xy=2x;y=2x+5;y=−23x  và  y=23x+5y=−23x+5 trên cùng một mặt phẳng tọa độ.

b) Bốn đường thẳng trên cắt nhau tạo thành tứ giác OABCOABC (OO là gốc tọa độ). Tứ giác OABCOABC có phải là hình bình hành không ? Vì sao ?

Giải:

a) Đồ thị các hàm số như ở hình bên.


b) Tứ giác OABCOABC là một hình bình hành vì đồ thị y=2x+5 song song với đồ thị y=2x (vì cùng có hệ số góc k=2), đồ thị y=2/3x+5ysong song với đồ thị y=2/3x (vì cùng có hệ số góc k=2/3x).

Bài 16 trang 51 sgk Toán 9 tập 1.

a) Vẽ đồ thị các hàm số y=xy=x   và  y=2x+2y=2x+2 trên mặt phẳng tọa độ.

b) Gọi A là giao điểm của hai đồ thị nói trên, tìm tọa độ điểm A.

c) Vẽ qua điểm B(0; 2) một đường thẳng song song với trục Ox, cắt đường thẳng y = x tại điểm C. Tìm tọa độ của điểm C rồi tính diện tích tam giác ABC (đơn vị đo trên các trục tọa độ là xentimét)

Giải:

a) Đồ thị như hình bên.

b) Giải phương trình hoành độ giao điểm: x=2x+2, ta được x=2y=2.

Vậy có tọa độ điểm A(-2; -2).

c) C(2; 2).

 =  BC . 4 = 2 . 2 = 4 (cm2).

Vì điểm C là giao điểm của đường thẳng qua B và song song với trục hoành với hàm số y=xy=x nên C là giao điểm của 2 hàm số sau:

{y=x y=2

Vậy ta có tọa độ điểm C(2;2)

Diện tích của tam giác ABC là:

SABC=12BC.4=2BC=2.2=4(cm2)

Bài 17 trang 51 sgk Toán 9 tập 1.

a) Vẽ đồ thị của các hàm số y=x+1y=x+1 và y=x+3y=−x+3 trên cùng một mặt phẳng tọa độ.

b) Hai đường thẳng y=x+1y=x+1 và y=x+3y=−x+3 cắt nhau tại C và cắt trục Ox theo thứ tự tại A và B. Tìm tọa độ của các điểm A, B, C.

c) Tính chu vi và diện tích của tam giác ABC (đơn vi đo trên các trục tọa độ là xentimét)

Giải:

a) Xem hình dưới đây:

b) Qua đồ thị, dễ dàng tìm được tọa độ của các điểm A, B, C bằng:

A(1;0),B(3;0),C(1;2)

c) Chu vi của tam giác ABC là:

AB+BC+AC=4+22+22=4+42(cm)

Diện tích tích của tam giác ABC là:

S=12AB.2=4(cm2)

Bài 18 trang 52 sgk Toán 9 tập 1

a) Biết rằng với x = 4 thì hàm số y = 3x + b có giá trị là 11. Tìm b. Vẽ đồ thị của hàm số với giá trị b vừa tìm được.

b) Biết rằng đồ thị của hàm số y = ax + 5 đi qua điểm A (-1; 3). Tìm a. Vẽ đồ thị của hàm số với giá trị a vừa tìm được.

Giải:

a) Thế x=4x=4  và  y=11y=11 vào y=3x+by=3x+b  

Ta có: 11=3.4+bb=111=3.4+b⇔b=−1.

Khi đó hàm số đã cho trở thành: y=3x1y=3x–1. Đây là đường thẳng đi qua 2 điểm A(0;1)A(0;−1) và B(13;0)B(13;0)

b) Đồ thị hàm số y=ax+5y=ax+5 đi qua điểm A(1;3)

3=a(1)+5a=2

Khi đó hàm số đã cho trở thành: y=2x+5. Đây là đường thẳng đi qua hai điểm A(0;5)và B (52;0)

 

Series Navigation<< Bài 2. Hàm số bậc nhất.Bài 4. Đường thẳng song song và đường thẳng cắt nhau. >>